Toladryl
Catalog No: FT-0675266
CAS No: 19804-27-4
- Chemical Name: Toladryl
- Molecular Formula: C18H23NO
- Molecular Weight: 269.4 g/mol
- InChI Key: PJUYQWIDNIAHIZ-UHFFFAOYSA-N
- InChI: InChI=1S/C18H23NO/c1-15-9-11-17(12-10-15)18(20-14-13-19(2)3)16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| CAS: | 19804-27-4 |
| MF: | C18H23NO |
| Flash_Point: | 107ºC |
| Product_Name: | N,N-dimethyl-2-[(4-methylphenyl)-phenylmethoxy]ethanamine |
| Density: | 1.014g/cm3 |
| FW: | 269.38100 |
| Bolling_Point: | 362.5ºC at 760mmHg |
| Refractive_Index: | 1.548 |
|---|---|
| Vapor_Pressure: | 1.93E-05mmHg at 25°C |
| MF: | C18H23NO |
| Flash_Point: | 107ºC |
| LogP: | 3.66260 |
| FW: | 269.38100 |
| Density: | 1.014g/cm3 |
| PSA: | 12.47000 |
| Bolling_Point: | 362.5ºC at 760mmHg |
| Exact_Mass: | 269.17800 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2922199090 |
Related Products
2-(1-Hydroxyethyl) Promazine Sulfoxide (mixture of diastereomers)
(2S)-1-[(2S)-2-amino-4-methylpentanoyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid